Molecular Structure:
CCD No.:CCD03380653
SELENA SEL10718223
Formula:C12 H25 N3 O2 S
MolWeight:275.414
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718223 |
| English Synonyms： | SELENA SEL10718223 |
| MDL Number.： | MFCD17113665 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCN1CCC(CC1)N(C)C2CS(=O)(=O)CC2N |
| InChi： | InChI=1S/C12H25N3O2S/c1-3-15-6-4-10(5-7-15)14(2)12-9-18(16,17)8-11(12)13/h10-12H,3-9,13H2,1-2H3 |
| InChiKey： | InChIKey=COSAHZDSYXKOIA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
