Molecular Structure:
CCD No.:CCD03380654
SELENA SEL10718224
Formula:C12 H27 N3 O2 S
MolWeight:277.43
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718224 |
| English Synonyms： | SELENA SEL10718224 |
| MDL Number.： | MFCD17113666 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(C)CN(CCN(C)C)C1CS(=O)(=O)CC1N |
| InChi： | InChI=1S/C12H27N3O2S/c1-10(2)7-15(6-5-14(3)4)12-9-18(16,17)8-11(12)13/h10-12H,5-9,13H2,1-4H3 |
| InChiKey： | InChIKey=VUNOCDFTMBLZKC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
