* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10718226 |
| English Synonyms: | SELENA SEL10718226 |
| MDL Number.: | MFCD17113668 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CN(CCc1ccccn1)C2CS(=O)(=O)CC2N |
| InChi: | InChI=1S/C12H19N3O2S/c1-15(7-5-10-4-2-3-6-14-10)12-9-18(16,17)8-11(12)13/h2-4,6,11-12H,5,7-9,13H2,1H3 |
| InChiKey: | InChIKey=RCZUQYQWBDRPKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.