Molecular Structure:
CCD No.:CCD03380657
SELENA SEL10718227
Formula:C11 H18 N2 O3 S
MolWeight:258.34
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718227 |
| English Synonyms： | SELENA SEL10718227 |
| MDL Number.： | MFCD17113669 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(o1)CN(C)C2CS(=O)(=O)CC2N |
| InChi： | InChI=1S/C11H18N2O3S/c1-8-3-4-9(16-8)5-13(2)11-7-17(14,15)6-10(11)12/h3-4,10-11H,5-7,12H2,1-2H3 |
| InChiKey： | InChIKey=WVSISETUYONZTQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
