Molecular Structure:
CCD No.:CCD03380661
SELENA SEL10718232
Formula:C10 H15 Br N2 O2 S2
MolWeight:339.276
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718232 |
| English Synonyms： | SELENA SEL10718232 |
| MDL Number.： | MFCD17113673 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CN(Cc1cc(sc1)Br)C2CS(=O)(=O)CC2N |
| InChi： | InChI=1S/C10H15BrN2O2S2/c1-13(3-7-2-10(11)16-4-7)9-6-17(14,15)5-8(9)12/h2,4,8-9H,3,5-6,12H2,1H3 |
| InChiKey： | InChIKey=BFRISJRDQZVNLQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
