Molecular Structure:
CCD No.:CCD03380663
SELENA SEL10718234
Formula:C12 H17 Br N2 O2 S
MolWeight:333.248
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718234 |
| English Synonyms： | SELENA SEL10718234 |
| MDL Number.： | MFCD17113675 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CN(Cc1ccc(cc1)Br)C2CS(=O)(=O)CC2N |
| InChi： | InChI=1S/C12H17BrN2O2S/c1-15(6-9-2-4-10(13)5-3-9)12-8-18(16,17)7-11(12)14/h2-5,11-12H,6-8,14H2,1H3 |
| InChiKey： | InChIKey=OEIMEEJSIPSKQK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
