* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10718236 |
| English Synonyms: | SELENA SEL10718236 |
| MDL Number.: | MFCD17113677 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1CN(CC(O1)(C)C)C2CS(=O)(=O)CC2N |
| InChi: | InChI=1S/C11H22N2O3S/c1-8-4-13(7-11(2,3)16-8)10-6-17(14,15)5-9(10)12/h8-10H,4-7,12H2,1-3H3 |
| InChiKey: | InChIKey=NDEHPWCJZIDJFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.