* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10718237 |
English Synonyms: | SELENA SEL10718237 |
MDL Number.: | MFCD17113678 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCC1CCN(CC1)C2CS(=O)(=O)CC2N |
InChi: | InChI=1S/C12H24N2O2S/c1-2-3-10-4-6-14(7-5-10)12-9-17(15,16)8-11(12)13/h10-12H,2-9,13H2,1H3 |
InChiKey: | InChIKey=NVGUQTVUKWNLFG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.