Molecular Structure:
CCD No.:CCD03380792
SELENA SEL10718371
Formula:C13 H15 N O4
MolWeight:249.264
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718371 |
| English Synonyms： | SELENA SEL10718371 |
| MDL Number.： | MFCD17113804 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | Cc1cccc(c1O)C(=O)NC(C2CC2)C(=O)O |
| InChi： | InChI=1S/C13H15NO4/c1-7-3-2-4-9(11(7)15)12(16)14-10(13(17)18)8-5-6-8/h2-4,8,10,15H,5-6H2,1H3,(H,14,16)(H,17,18) |
| InChiKey： | InChIKey=GOROVOZGNOEOBH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
