Molecular Structure:
CCD No.:CCD03380794
SELENA SEL10718373
Formula:C10 H10 Cl2 N2 O3
MolWeight:277.106
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718373 |
| English Synonyms： | SELENA SEL10718373 |
| MDL Number.： | MFCD17113806 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | c1c(c([nH]c1C(=O)NC(C2CC2)C(=O)O)Cl)Cl |
| InChi： | InChI=1S/C10H10Cl2N2O3/c11-5-3-6(13-8(5)12)9(15)14-7(10(16)17)4-1-2-4/h3-4,7,13H,1-2H2,(H,14,15)(H,16,17) |
| InChiKey： | InChIKey=PZYRSRHOBDTBIR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
