Molecular Structure:
CCD No.:CCD03380808
SELENA SEL10718387
Formula:C12 H11 Br I N O3
MolWeight:424.027
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718387 |
| English Synonyms： | SELENA SEL10718387 |
| MDL Number.： | MFCD17113820 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1cc(c(cc1Br)C(=O)NC(C2CC2)C(=O)O)I |
| InChi： | InChI=1S/C12H11BrINO3/c13-7-3-4-9(14)8(5-7)11(16)15-10(12(17)18)6-1-2-6/h3-6,10H,1-2H2,(H,15,16)(H,17,18) |
| InChiKey： | InChIKey=MRKWKVOIMKUYBO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
