Molecular Structure:
CCD No.:CCD03380880
SELENA SEL10718459
Formula:C13 H18 N2 O3
MolWeight:250.296
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718459 |
| English Synonyms： | SELENA SEL10718459 |
| MDL Number.： | MFCD17113892 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCCn1cccc1C(=O)NC(C2CC2)C(=O)O |
| InChi： | InChI=1S/C13H18N2O3/c1-2-7-15-8-3-4-10(15)12(16)14-11(13(17)18)9-5-6-9/h3-4,8-9,11H,2,5-7H2,1H3,(H,14,16)(H,17,18) |
| InChiKey： | InChIKey=CUDDKHPRWUEUHZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
