Molecular Structure:
CCD No.:CCD03380882
SELENA SEL10718461
Formula:C13 H15 Cl N2 O3
MolWeight:282.725
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718461 |
| English Synonyms： | SELENA SEL10718461 |
| MDL Number.： | MFCD17113894 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1c(cn(c1C(=O)NC(C2CC2)C(=O)O)C3CC3)Cl |
| InChi： | InChI=1S/C13H15ClN2O3/c14-8-5-10(16(6-8)9-3-4-9)12(17)15-11(13(18)19)7-1-2-7/h5-7,9,11H,1-4H2,(H,15,17)(H,18,19) |
| InChiKey： | InChIKey=VFQYLPILTMTCLW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
