Molecular Structure:
CCD No.:CCD03380915
SELENA SEL10718494
Formula:C10 H17 N O6 S2
MolWeight:311.377
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718494 |
| English Synonyms： | SELENA SEL10718494 |
| MDL Number.： | MFCD17113927 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | C1CC1C(C(=O)O)NS(=O)(=O)C2CCS(=O)(=O)CC2 |
| InChi： | InChI=1S/C10H17NO6S2/c12-10(13)9(7-1-2-7)11-19(16,17)8-3-5-18(14,15)6-4-8/h7-9,11H,1-6H2,(H,12,13) |
| InChiKey： | InChIKey=QVRVVOJPMSSHQV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
