Molecular Structure:
CCD No.:CCD03380917
SELENA SEL10718496
Formula:C12 H21 N O4 S
MolWeight:275.367
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10718496 |
| English Synonyms： | SELENA SEL10718496 |
| MDL Number.： | MFCD17113929 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | C1CCC(CC1)CS(=O)(=O)NC(C2CC2)C(=O)O |
| InChi： | InChI=1S/C12H21NO4S/c14-12(15)11(10-6-7-10)13-18(16,17)8-9-4-2-1-3-5-9/h9-11,13H,1-8H2,(H,14,15) |
| InChiKey： | InChIKey=ZLABURZUYWWKCO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
