* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 3560167 |
English Synonyms: | OTAVA-BB 3560167 |
MDL Number.: | MFCD17114273 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1C(=O)O)F)NC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C11H12FNO4S/c12-9-5-7(11(14)15)1-2-10(9)13-8-3-4-18(16,17)6-8/h1-2,5,8,13H,3-4,6H2,(H,14,15) |
InChiKey: | InChIKey=GQNDLYDDWTZSGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.