* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10878339 |
English Synonyms: | SELENA SEL10878339 |
MDL Number.: | MFCD17115273 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | COCCNCC1CC12CCc3ccccc3C2 |
InChi: | InChI=1S/C16H23NO/c1-18-9-8-17-12-15-11-16(15)7-6-13-4-2-3-5-14(13)10-16/h2-5,15,17H,6-12H2,1H3 |
InChiKey: | InChIKey=VQMJKYJGGNYOKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.