* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6181326 |
English Synonyms: | ABAMACHEM ABA-6181326 |
MDL Number.: | MFCD17115303 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1c(cnn1C2CCCCCC2O)C(=O)O |
InChi: | InChI=1S/C12H18N2O3/c1-8-9(12(16)17)7-13-14(8)10-5-3-2-4-6-11(10)15/h7,10-11,15H,2-6H2,1H3,(H,16,17) |
InChiKey: | InChIKey=FGWWMXBGVGJNBN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.