* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(3,5-DICHLOROPHENYL)-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
English Synonyms: | 9-(3,5-DICHLOROPHENYL)-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
MDL Number.: | MFCD17115332 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1c(cc(cc1Cl)Cl)N2C3CCCC2CC(=O)C3 |
InChi: | InChI=1S/C14H15Cl2NO/c15-9-4-10(16)6-13(5-9)17-11-2-1-3-12(17)8-14(18)7-11/h4-6,11-12H,1-3,7-8H2 |
InChiKey: | InChIKey=FZWQHUFBJZYVDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.