* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(2,6-DIMETHYLPHENYL)-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
English Synonyms: | 9-(2,6-DIMETHYLPHENYL)-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
MDL Number.: | MFCD17115422 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1N2C3CCCC2CC(C3)N)C |
InChi: | InChI=1S/C16H24N2/c1-11-5-3-6-12(2)16(11)18-14-7-4-8-15(18)10-13(17)9-14/h3,5-6,13-15H,4,7-10,17H2,1-2H3 |
InChiKey: | InChIKey=WQLKTNRFHCGOES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.