* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-[1-(FURAN-2-YL)ETHYL]-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
English Synonyms: | 9-[1-(FURAN-2-YL)ETHYL]-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
MDL Number.: | MFCD17115475 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(c1ccco1)N2C3CCCC2CC(C3)N |
InChi: | InChI=1S/C14H22N2O/c1-10(14-6-3-7-17-14)16-12-4-2-5-13(16)9-11(15)8-12/h3,6-7,10-13H,2,4-5,8-9,15H2,1H3 |
InChiKey: | InChIKey=PVUUAAAWGBNNHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.