Molecular Structure:
CCD No.:CCD03382572
SELENA SEL10720255
Formula:C13 H19 N3 O2
MolWeight:249.312
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10720255 |
| English Synonyms： | SELENA SEL10720255 |
| MDL Number.： | MFCD17115683 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | COCCn1cc(cn1)N2C3CCC2CC(=O)C3 |
| InChi： | InChI=1S/C13H19N3O2/c1-18-5-4-15-9-12(8-14-15)16-10-2-3-11(16)7-13(17)6-10/h8-11H,2-7H2,1H3 |
| InChiKey： | InChIKey=JUYOSTXBLJBIJF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
