* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(3,5-DIMETHYL-1H-PYRAZOL-4-YL)-N-ETHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
| English Synonyms: | 8-(3,5-DIMETHYL-1H-PYRAZOL-4-YL)-N-ETHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
| MDL Number.: | MFCD17115758 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCNC1CC2CCC(C1)N2c3c([nH]nc3C)C |
| InChi: | InChI=1S/C14H24N4/c1-4-15-11-7-12-5-6-13(8-11)18(12)14-9(2)16-17-10(14)3/h11-13,15H,4-8H2,1-3H3,(H,16,17) |
| InChiKey: | InChIKey=WCOASXOBNJLORS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.