Molecular Structure:
CCD No.:CCD03383114
SELENA SEL10720908
Formula:C14 H27 N3
MolWeight:237.388
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10720908 |
| English Synonyms： | SELENA SEL10720908 |
| MDL Number.： | MFCD17116314 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCCCC(CC)(Cc1cnn(c1)C)CNC |
| InChi： | InChI=1S/C14H27N3/c1-5-7-8-14(6-2,12-15-3)9-13-10-16-17(4)11-13/h10-11,15H,5-9,12H2,1-4H3 |
| InChiKey： | InChIKey=PTFYUKKXKXIUGD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
