Molecular Structure:
CCD No.:CCD03383480
SELENA SEL10721310
Formula:C15 H27 N3
MolWeight:249.399
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10721310 |
| English Synonyms： | SELENA SEL10721310 |
| MDL Number.： | MFCD17116705 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCNCCCc1cnn(c1)C2CCCCCC2 |
| InChi： | InChI=1S/C15H27N3/c1-2-16-11-7-8-14-12-17-18(13-14)15-9-5-3-4-6-10-15/h12-13,15-16H,2-11H2,1H3 |
| InChiKey： | InChIKey=IOKIZGUHBKKPSM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
