Molecular Structure:
CCD No.:CCD03383482
SELENA SEL10721312
Formula:C15 H20 N4
MolWeight:256.351
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10721312 |
| English Synonyms： | SELENA SEL10721312 |
| MDL Number.： | MFCD17116707 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cc1ccnc(c1)n2cc(cn2)CCCNC3CC3 |
| InChi： | InChI=1S/C15H20N4/c1-12-6-8-17-15(9-12)19-11-13(10-18-19)3-2-7-16-14-4-5-14/h6,8-11,14,16H,2-5,7H2,1H3 |
| InChiKey： | InChIKey=VPTHTAVWWQOQMP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
