Molecular Structure:
CCD No.:CCD03383485
SELENA SEL10721315
Formula:C12 H15 N7
MolWeight:257.299
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10721315 |
| English Synonyms： | SELENA SEL10721315 |
| MDL Number.： | MFCD17116710 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | CNCCCc1cnn(c1)c2c3c(nc[nH]3)ncn2 |
| InChi： | InChI=1S/C12H15N7/c1-13-4-2-3-9-5-18-19(6-9)12-10-11(15-7-14-10)16-8-17-12/h5-8,13H,2-4H2,1H3,(H,14,15,16,17) |
| InChiKey： | InChIKey=HGHZOTSCNDIKMA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
