* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6181613 |
English Synonyms: | ABAMACHEM ABA-6181613 |
MDL Number.: | MFCD17117688 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNCC1(CCOC1)Cc2ccc(s2)CC |
InChi: | InChI=1S/C15H25NOS/c1-3-8-16-11-15(7-9-17-12-15)10-14-6-5-13(4-2)18-14/h5-6,16H,3-4,7-12H2,1-2H3 |
InChiKey: | InChIKey=HBDRLUXERIXHDF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.