* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6181353 |
English Synonyms: | ABAMACHEM ABA-6181353 |
MDL Number.: | MFCD17117699 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COCCNCC1(CCOC1)Cc2cccs2 |
InChi: | InChI=1S/C13H21NO2S/c1-15-7-5-14-10-13(4-6-16-11-13)9-12-3-2-8-17-12/h2-3,8,14H,4-7,9-11H2,1H3 |
InChiKey: | InChIKey=MBLRENXXYHJTET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.