Molecular Structure:
CCD No.:CCD03384564
SELENA SEL10723214
Formula:C11 H12 Cl N5 O
MolWeight:265.703
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723214 |
| English Synonyms： | SELENA SEL10723214 |
| MDL Number.： | MFCD17117949 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CC(CCl)C(=O)Nc1cccnc1n2cncn2 |
| InChi： | InChI=1S/C11H12ClN5O/c1-8(5-12)11(18)16-9-3-2-4-14-10(9)17-7-13-6-15-17/h2-4,6-8H,5H2,1H3,(H,16,18) |
| InChiKey： | InChIKey=LMUCIEKJRHVADA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
