* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10723389 |
| English Synonyms: | SELENA SEL10723389 |
| MDL Number.: | MFCD17118123 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCCn1cc(cn1)CNCC |
| InChi: | InChI=1S/C15H29N3/c1-3-5-6-7-8-9-10-11-18-14-15(13-17-18)12-16-4-2/h13-14,16H,3-12H2,1-2H3 |
| InChiKey: | InChIKey=BBOYQUVKFBZDFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.