Molecular Structure:
CCD No.:CCD03384832
SELENA SEL10723503
Formula:C13 H25 N3 O
MolWeight:239.361
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723503 |
| English Synonyms： | SELENA SEL10723503 |
| MDL Number.： | MFCD17118236 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCC(c1cnn(c1)CCOC(C)C)NCC |
| InChi： | InChI=1S/C13H25N3O/c1-5-13(14-6-2)12-9-15-16(10-12)7-8-17-11(3)4/h9-11,13-14H,5-8H2,1-4H3 |
| InChiKey： | InChIKey=UPEYPUNYVOCUKA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
