Molecular Structure:
CCD No.:CCD03384833
SELENA SEL10723504
Formula:C16 H31 N3
MolWeight:265.442
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723504 |
| English Synonyms： | SELENA SEL10723504 |
| MDL Number.： | MFCD17118237 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCCCCCCn1cc(cn1)C(CC)NCCC |
| InChi： | InChI=1S/C16H31N3/c1-4-7-8-9-10-12-19-14-15(13-18-19)16(6-3)17-11-5-2/h13-14,16-17H,4-12H2,1-3H3 |
| InChiKey： | InChIKey=LOCIJCXWIRMZEV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
