* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10723543 |
English Synonyms: | SELENA SEL10723543 |
MDL Number.: | MFCD17118276 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(c1cnn(c1)CCCOCC(F)(F)F)O |
InChi: | InChI=1S/C10H15F3N2O2/c1-8(16)9-5-14-15(6-9)3-2-4-17-7-10(11,12)13/h5-6,8,16H,2-4,7H2,1H3 |
InChiKey: | InChIKey=YFGYVPCOWUZCOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.