* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10723544 |
English Synonyms: | SELENA SEL10723544 |
MDL Number.: | MFCD17118277 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(c1cnn(c1)Cc2ccc(cc2)C(F)(F)F)O |
InChi: | InChI=1S/C13H13F3N2O/c1-9(19)11-6-17-18(8-11)7-10-2-4-12(5-3-10)13(14,15)16/h2-6,8-9,19H,7H2,1H3 |
InChiKey: | InChIKey=KVLVXYWNHCIIRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.