* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-N-METHYL-2H,3H,4H,8H,9H,10H,11H-NAPHTHO[1,2-B][1,4]DIOXEPIN-11-AMINE |
| English Synonyms: | 7-CHLORO-N-METHYL-2H,3H,4H,8H,9H,10H,11H-NAPHTHO[1,2-B][1,4]DIOXEPIN-11-AMINE |
| MDL Number.: | MFCD17118405 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CNC1CCCc2c1c3c(cc2Cl)OCCCO3 |
| InChi: | InChI=1S/C14H18ClNO2/c1-16-11-5-2-4-9-10(15)8-12-14(13(9)11)18-7-3-6-17-12/h8,11,16H,2-7H2,1H3 |
| InChiKey: | InChIKey=FWGLOOCVOHIXLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.