* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10723782 |
| English Synonyms: | SELENA SEL10723782 |
| MDL Number.: | MFCD17118512 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCn1ccnc1COc2cccc3c2NCCC3 |
| InChi: | InChI=1S/C15H19N3O/c1-2-18-10-9-16-14(18)11-19-13-7-3-5-12-6-4-8-17-15(12)13/h3,5,7,9-10,17H,2,4,6,8,11H2,1H3 |
| InChiKey: | InChIKey=YDXYLANONMERIE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.