Molecular Structure:
CCD No.:CCD03385106
SELENA SEL10723783
Formula:C12 H21 N3 O2
MolWeight:239.317
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723783 |
| English Synonyms： | SELENA SEL10723783 |
| MDL Number.： | MFCD17118513 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CCn1ccnc1CN(C)CCCC(=O)OC |
| InChi： | InChI=1S/C12H21N3O2/c1-4-15-9-7-13-11(15)10-14(2)8-5-6-12(16)17-3/h7,9H,4-6,8,10H2,1-3H3 |
| InChiKey： | InChIKey=GEUPKHRAVUWTLC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
