Molecular Structure:
CCD No.:CCD03385107
SELENA SEL10723784
Formula:C13 H23 N3 O
MolWeight:237.345
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723784 |
| English Synonyms： | SELENA SEL10723784 |
| MDL Number.： | MFCD17118514 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCn1ccnc1CN2CCCCC2CCO |
| InChi： | InChI=1S/C13H23N3O/c1-2-15-9-7-14-13(15)11-16-8-4-3-5-12(16)6-10-17/h7,9,12,17H,2-6,8,10-11H2,1H3 |
| InChiKey： | InChIKey=NICSOQMILRNRKG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
