Molecular Structure:
CCD No.:CCD03385108
SELENA SEL10723785
Formula:C15 H21 N3 O
MolWeight:259.351
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723785 |
| English Synonyms： | SELENA SEL10723785 |
| MDL Number.： | MFCD17118515 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCn1ccnc1CN(CCO)Cc2ccccc2 |
| InChi： | InChI=1S/C15H21N3O/c1-2-18-9-8-16-15(18)13-17(10-11-19)12-14-6-4-3-5-7-14/h3-9,19H,2,10-13H2,1H3 |
| InChiKey： | InChIKey=CTZNJJZJQCWXEI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
