Molecular Structure:
CCD No.:CCD03385111
SELENA SEL10723788
Formula:C12 H13 Cl N4 O2
MolWeight:280.714
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723788 |
| English Synonyms： | SELENA SEL10723788 |
| MDL Number.： | MFCD17118518 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | c1cc2c(cc1CCn3c(nnn3)CCl)OCCO2 |
| InChi： | InChI=1S/C12H13ClN4O2/c13-8-12-14-15-16-17(12)4-3-9-1-2-10-11(7-9)19-6-5-18-10/h1-2,7H,3-6,8H2 |
| InChiKey： | InChIKey=VIMPEQUOWVCSEC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
