* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10723794 |
| English Synonyms: | SELENA SEL10723794 |
| MDL Number.: | MFCD17118524 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCNCc1nnnn1c2cccc(c2)F |
| InChi: | InChI=1S/C11H14FN5/c1-2-6-13-8-11-14-15-16-17(11)10-5-3-4-9(12)7-10/h3-5,7,13H,2,6,8H2,1H3 |
| InChiKey: | InChIKey=AMNNEYONPXPNRA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.