* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10723809 |
English Synonyms: | SELENA SEL10723809 |
MDL Number.: | MFCD17118539 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCNCc1nnnn1c2ccc(cc2)OCC |
InChi: | InChI=1S/C12H17N5O/c1-3-13-9-12-14-15-16-17(12)10-5-7-11(8-6-10)18-4-2/h5-8,13H,3-4,9H2,1-2H3 |
InChiKey: | InChIKey=FNWIXQOMQZDKIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.