Molecular Structure:
CCD No.:CCD03385137
SELENA SEL10723814
Formula:C12 H17 N5 O
MolWeight:247.3
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723814 |
| English Synonyms： | SELENA SEL10723814 |
| MDL Number.： | MFCD17118544 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CCCNCc1nnnn1c2ccc(cc2)OC |
| InChi： | InChI=1S/C12H17N5O/c1-3-8-13-9-12-14-15-16-17(12)10-4-6-11(18-2)7-5-10/h4-7,13H,3,8-9H2,1-2H3 |
| InChiKey： | InChIKey=CRCNBSMTRYPPQM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
