Molecular Structure:
CCD No.:CCD03385207
OTAVA-BB 2201859
Formula:C12 H17 N5 O2
MolWeight:263.299
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2201859 |
| English Synonyms： | OTAVA-BB 2201859 |
| MDL Number.： | MFCD17118614 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | CCOc1ccc(cc1OCC)n2c(nnn2)CN |
| InChi： | InChI=1S/C12H17N5O2/c1-3-18-10-6-5-9(7-11(10)19-4-2)17-12(8-13)14-15-16-17/h5-7H,3-4,8,13H2,1-2H3 |
| InChiKey： | InChIKey=XXENULLDVLTLPH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
