Molecular Structure:
CCD No.:CCD03385252
OTAVA-BB 2201785
Formula:C12 H17 N5
MolWeight:231.301
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2201785 |
| English Synonyms： | OTAVA-BB 2201785 |
| MDL Number.： | MFCD17118659 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCCCc1ccc(cc1)n2c(nnn2)CN |
| InChi： | InChI=1S/C12H17N5/c1-2-3-4-10-5-7-11(8-6-10)17-12(9-13)14-15-16-17/h5-8H,2-4,9,13H2,1H3 |
| InChiKey： | InChIKey=FDUQVMMNONBLFI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
