Molecular Structure:
CCD No.:CCD03385289
SELENA SEL10723966
Formula:C10 H11 Cl2 N5
MolWeight:272.138
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723966 |
| English Synonyms： | SELENA SEL10723966 |
| MDL Number.： | MFCD17118696 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1Cl)Cl)CCn2c(nnn2)CN |
| InChi： | InChI=1S/C10H11Cl2N5/c11-8-2-1-7(9(12)5-8)3-4-17-10(6-13)14-15-16-17/h1-2,5H,3-4,6,13H2 |
| InChiKey： | InChIKey=PAULXTNHONIKNL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
