Molecular Structure:
CCD No.:CCD03385295
SELENA SEL10723972
Formula:C12 H17 N5
MolWeight:231.301
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10723972 |
| English Synonyms： | SELENA SEL10723972 |
| MDL Number.： | MFCD17118702 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCNCc1nnnn1C(C)c2ccccc2 |
| InChi： | InChI=1S/C12H17N5/c1-3-13-9-12-14-15-16-17(12)10(2)11-7-5-4-6-8-11/h4-8,10,13H,3,9H2,1-2H3 |
| InChiKey： | InChIKey=ZWRYFCGXWQEQOB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
