Molecular Structure:
CCD No.:CCD03385406
SELENA SEL10724083
Formula:C12 H19 N5 S
MolWeight:265.383
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10724083 |
| English Synonyms： | SELENA SEL10724083 |
| MDL Number.： | MFCD17118813 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(C)CNCc1nnnn1CCc2ccsc2 |
| InChi： | InChI=1S/C12H19N5S/c1-10(2)7-13-8-12-14-15-16-17(12)5-3-11-4-6-18-9-11/h4,6,9-10,13H,3,5,7-8H2,1-2H3 |
| InChiKey： | InChIKey=VNKJGTBLFBDXQN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
