Molecular Structure:
CCD No.:CCD03385407
SELENA SEL10724084
Formula:C11 H15 N5 S
MolWeight:249.34
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10724084 |
| English Synonyms： | SELENA SEL10724084 |
| MDL Number.： | MFCD17118814 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1cscc1CCn2c(nnn2)CNC3CC3 |
| InChi： | InChI=1S/C11H15N5S/c1-2-10(1)12-7-11-13-14-15-16(11)5-3-9-4-6-17-8-9/h4,6,8,10,12H,1-3,5,7H2 |
| InChiKey： | InChIKey=ZSDIQMHQWSSQIY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
